Difference between revisions of "Ec-01 004520"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene Ec-01_004520 == * left end position: ** 3888355 * transcription direction: ** NEGATIVE * right end position: ** 3894406 * centisome position: ** 37.6...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_004520 == |
− | * | + | * left end position: |
− | ** | + | ** 3888355 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3894406 |
− | * | + | * centisome position: |
− | ** | + | ** 37.682117 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0018_0199 |
+ | ** Esi0018_0199 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6.3.2.25-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=3888355}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3894406}} | |
− | + | {{#set: centisome position=37.682117 }} | |
− | + | {{#set: common name=Esi_0018_0199|Esi0018_0199}} | |
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:51, 21 March 2018
Gene Ec-01_004520
- left end position:
- 3888355
- transcription direction:
- NEGATIVE
- right end position:
- 3894406
- centisome position:
- 37.682117
- Synonym(s):
- Esi_0018_0199
- Esi0018_0199
Reactions associated
- Reaction: 6.3.2.25-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome