Difference between revisions of "Ec-12 003840"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * smiles: ** [CH](C(C(COP([O-])([O-])=O)O)O)=O * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-12_003840 == * left end position: ** 3578107 * transcription direction: ** NEGATIVE * right end position: ** 3588062 * centisome position: ** 42.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_003840 == |
− | * | + | * left end position: |
− | ** | + | ** 3578107 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3588062 |
− | * | + | * centisome position: |
− | ** | + | ** 42.92328 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0090_0064 |
− | ** | + | ** Esi0090_0064 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3578107}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3588062}} | |
− | + | {{#set: centisome position=42.92328 }} | |
− | + | {{#set: common name=Esi_0090_0064|Esi0090_0064}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:51, 21 March 2018
Gene Ec-12_003840
- left end position:
- 3578107
- transcription direction:
- NEGATIVE
- right end position:
- 3588062
- centisome position:
- 42.92328
- Synonym(s):
- Esi_0090_0064
- Esi0090_0064
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome