Difference between revisions of "Ec-20 004980"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-20_004980 == * left end position: ** 4993461 * transcription direction: ** NEGATIVE * right end position: ** 5005905 * centisome position: ** 96.8...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_004980 == |
− | * | + | * left end position: |
− | ** | + | ** 4993461 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5005905 |
− | * | + | * centisome position: |
− | ** | + | ** 96.83967 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0231_0017 |
− | ** | + | ** Esi0231_0017 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: ec-number | |
− | * | + | == Pathways associated == |
− | == | + | * [[PWY-1001]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=4993461}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5005905}} | |
− | + | {{#set: centisome position=96.83967 }} | |
− | + | {{#set: common name=Esi_0231_0017|Esi0231_0017}} | |
− | + | {{#set: reaction associated=CELLULOSE-SYNTHASE-UDP-FORMING-RXN}} | |
− | + | {{#set: pathway associated=PWY-1001}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:51, 21 March 2018
Gene Ec-20_004980
- left end position:
- 4993461
- transcription direction:
- NEGATIVE
- right end position:
- 5005905
- centisome position:
- 96.83967
- Synonym(s):
- Esi_0231_0017
- Esi0231_0017
Reactions associated
- Reaction: CELLULOSE-SYNTHASE-UDP-FORMING-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome