Difference between revisions of "RXN-17473"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17473 RXN-17473] == * direction: ** REVERSIBLE * common name: ** biotin synthase * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17473 RXN-17473] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
+
 
* common name:
 
* common name:
** OPC4-3-hydroxyacyl-CoA
+
** biotin synthase
* molecular weight:
+
** 999.813   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10703]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-5662]][c] '''<=>''' 1 [[MET]][c] '''+''' 1 [[BIOTIN]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[PROTON]][c]
* [[RXN-10705]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 9-mercaptodethiobiotin[c] '''<=>''' 1 L-methionine[c] '''+''' 1 biotin[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_000980]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
+
{{#set: common name=biotin synthase}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: gene associated=Ec-24_000980}}
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=999.813    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: consumed by=RXN-10703}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-10705}}
+

Latest revision as of 20:51, 21 March 2018

Reaction RXN-17473

  • direction:
    • REVERSIBLE
  • common name:
    • biotin synthase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-adenosyl-L-methionine[c] + 1 9-mercaptodethiobiotin[c] <=> 1 L-methionine[c] + 1 biotin[c] + 1 5'-deoxyadenosine[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links