Difference between revisions of "3.1.1.47-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.1.47-RXN 3.1.1.47-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-alkyl-2-acetylglyce...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.1.47-RXN 3.1.1.47-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1-alkyl-2-acetylglycerophosphocholine esterase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.1.47 EC-3.1.1.47] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[Alkyl-acetyl-glycero-phosphocholines]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[1-Alkyl-sn-glycero-3-phosphocholines]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine[c] '''+''' 1 H2O[c] '''=>''' 1 a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine[c] '''+''' 1 acetate[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_002000]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17780 17780] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04452 R04452] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=1-alkyl-2-acetylglycerophosphocholine esterase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-3.1.1.47}} |
− | {{#set: | + | {{#set: gene associated=Ec-12_002000}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction 3.1.1.47-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 1-alkyl-2-acetylglycerophosphocholine esterase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Alkyl-acetyl-glycero-phosphocholines[c] + 1 WATER[c] => 1 1-Alkyl-sn-glycero-3-phosphocholines[c] + 1 ACET[c] + 1 PROTON[c]
- With common name(s):
- 1 a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine[c] + 1 H2O[c] => 1 a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine[c] + 1 acetate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_002000
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links