Difference between revisions of "Ec-20 004180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...")
(Created page with "Category:Gene == Gene Ec-20_004180 == * left end position: ** 4367532 * transcription direction: ** POSITIVE * right end position: ** 4380177 * centisome position: ** 84.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Gene Ec-20_004180 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
+
** 4367532
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** delphinidin-3-O-β-D-glucoside
+
** 4380177
−
* molecular weight:
+
* centisome position:
−
** 463.374    
+
** 84.70084    
 
* Synonym(s):
 
* Synonym(s):
−
** delfinidin-3-O-glucoside
+
** Esi_0010_0135
 +
** Esi0010_0135
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8228]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPK12010278
+
{{#set: left end position=4367532}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559]
+
{{#set: right end position=4380177}}
−
* CHEBI:
+
{{#set: centisome position=84.70084   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463]
+
{{#set: common name=Esi_0010_0135|Esi0010_0135}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138]
+
−
* HMDB : HMDB37997
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}}
+
−
{{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}}
+
−
{{#set: common name=delphinidin-3-O-β-D-glucoside}}
+
−
{{#set: molecular weight=463.374   }}
+
−
{{#set: common name=delfinidin-3-O-glucoside}}
+
−
{{#set: consumed by=RXN-8228}}
+

Latest revision as of 19:51, 21 March 2018

Gene Ec-20_004180

  • left end position:
    • 4367532
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4380177
  • centisome position:
    • 84.70084
  • Synonym(s):
    • Esi_0010_0135
    • Esi0010_0135

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_004180&oldid=29849"