Difference between revisions of "CPD-11527"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10696 RXN-10696] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl-CoA oxidase/dehydrogen...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4) |
| + | * inchi key: | ||
| + | ** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** OPC4-3-hydroxyacyl-CoA |
| − | + | * molecular weight: | |
| − | + | ** 999.813 | |
| − | * | + | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10703]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10705]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301] | |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}} |
| − | + | {{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}} | |
| − | + | {{#set: common name=OPC4-3-hydroxyacyl-CoA}} | |
| − | {{#set: | + | {{#set: molecular weight=999.813 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-10703}} |
| − | {{#set: | + | {{#set: produced by=RXN-10705}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:52, 21 March 2018
Contents
Metabolite CPD-11527
- smiles:
- CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
- inchi key:
- InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
- common name:
- OPC4-3-hydroxyacyl-CoA
- molecular weight:
- 999.813
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.
