Difference between revisions of "Ec-20 003120"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * smiles: ** C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-20_003120 == * left end position: ** 3227044 * transcription direction: ** NEGATIVE * right end position: ** 3235173 * centisome position: ** 62.5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_003120 == |
− | * | + | * left end position: |
− | ** | + | ** 3227044 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3235173 |
− | * | + | * centisome position: |
− | ** | + | ** 62.583015 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0123_0042 |
− | ** | + | ** Esi0123_0042 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[4 | + | * Reaction: [[4.2.2.10-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-14897]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3227044}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3235173}} | |
− | + | {{#set: centisome position=62.583015 }} | |
− | + | {{#set: common name=Esi_0123_0042|Esi0123_0042}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Ec-20_003120
- left end position:
- 3227044
- transcription direction:
- NEGATIVE
- right end position:
- 3235173
- centisome position:
- 62.583015
- Synonym(s):
- Esi_0123_0042
- Esi0123_0042
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome