Difference between revisions of "Ec-07 000620"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-07_000620 == * left end position: ** 568258 * transcription direction: ** POSITIVE * right end position: ** 575874 * centisome position: ** 7.3585...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_000620 == |
− | * | + | * left end position: |
− | ** | + | ** 568258 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 575874 |
− | * | + | * centisome position: |
− | ** | + | ** 7.358538 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0057_0043 | ||
+ | ** Esi0057_0043 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-17203]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=568258}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=575874}} | |
− | + | {{#set: centisome position=7.358538 }} | |
− | + | {{#set: common name=Esi_0057_0043|Esi0057_0043}} | |
− | + | {{#set: reaction associated=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-17203}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Ec-07_000620
- left end position:
- 568258
- transcription direction:
- POSITIVE
- right end position:
- 575874
- centisome position:
- 7.358538
- Synonym(s):
- Esi_0057_0043
- Esi0057_0043
Reactions associated
- Reaction: GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17203
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome