Difference between revisions of "Ec-21 005150"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Ec-21_005150 == * left end position: ** 6061677 * transcription direction: ** NEGATIVE * right end position: ** 6062176 * centisome position: ** 82.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] ==
+
== Gene Ec-21_005150 ==
−
* smiles:
+
* left end position:
−
** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6061677
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (11Z)-3-oxo-hexadecenoyl-CoA
+
** 6062176
−
* molecular weight:
+
* centisome position:
−
** 1013.883    
+
** 82.135216    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0155_0019
 +
** Esi0155_0019
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1501_METACYC18.5]]
−
* [[RXN-16559]]
+
** Source: [[manual-1_cycrxns_to_add]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-15065]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15067]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15068]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16138]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16139]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17735]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17736]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-6725]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY66-397]]
 +
* [[PWY-7409]]
 +
* [[PWY66-394]]
 +
* [[PWY66-395]]
 +
* [[PWY-7783]]
 +
* [[PWY-7417]]
 +
* [[PWY-7416]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6061677}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=6062176}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021]
+
{{#set: centisome position=82.135216    }}
−
{{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0155_0019|Esi0155_0019}}
−
{{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}}
+
{{#set: reaction associated=RXN-1501_METACYC18.5|RXN-15065|RXN-15067|RXN-15068|RXN-16138|RXN-16139|RXN-17735|RXN-17736|RXN0-6725}}
−
{{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}}
+
{{#set: pathway associated=PWY66-397|PWY-7409|PWY66-394|PWY66-395|PWY-7783|PWY-7417|PWY-7416}}
−
{{#set: molecular weight=1013.883    }}
+
−
{{#set: produced by=RXN-16559}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-21_005150

  • left end position:
    • 6061677
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6062176
  • centisome position:
    • 82.135216
  • Synonym(s):
    • Esi_0155_0019
    • Esi0155_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_005150&oldid=29924"