Difference between revisions of "Trans-D3-cis-D9-hexadecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] == * smiles: ** C1(=NC(C(N)=O)C(N)=N1) * inchi key: ** InChIKey=PYNDTGFTPOZG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D9-hexadecenoyl-ACPs Trans-D3-cis-D9-hexadecenoyl-ACPs] == * common name: ** a tra...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3762 CPD-3762] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D9-hexadecenoyl-ACPs Trans-D3-cis-D9-hexadecenoyl-ACPs] ==
* smiles:
+
** C1(=NC(C(N)=O)C(N)=N1)
+
* inchi key:
+
** InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 5-amino-4-imidazolecarboxyamide
+
** a trans-Δ3-cis-Δ9-hexadecenoyl-[acp]
* molecular weight:
+
** 126.118   
+
 
* Synonym(s):
 
* Synonym(s):
** 1H-imidazole-4-carboxamide, 5-amino-
 
** 5(4)-amino-4(5)-imidazolecarboxamide
 
** 5-aminoimidazole-4-carboxamide
 
** 4-amino-5-carbamoylimidazole
 
** 4-amino-5-imidazolecarboxamide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10661]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10660]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14270]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a trans-Δ3-cis-Δ9-hexadecenoyl-[acp]}}
** [http://www.genome.jp/dbget-bin/www_bget?C04051 C04051]
+
{{#set: consumed by=RXN-10661}}
* CHEBI:
+
{{#set: produced by=RXN-10660}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2030 2030]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202832 25202832]
+
* HMDB : HMDB03192
+
{{#set: smiles=C1(=NC(C(N)=O)C(N)=N1)}}
+
{{#set: inchi key=InChIKey=PYNDTGFTPOZGRW-UHFFFAOYSA-N}}
+
{{#set: common name=5-amino-4-imidazolecarboxyamide}}
+
{{#set: molecular weight=126.118    }}
+
{{#set: common name=1H-imidazole-4-carboxamide, 5-amino-|5(4)-amino-4(5)-imidazolecarboxamide|5-aminoimidazole-4-carboxamide|4-amino-5-carbamoylimidazole|4-amino-5-imidazolecarboxamide}}
+
{{#set: reversible reaction associated=RXN-14270}}
+

Latest revision as of 20:52, 21 March 2018

Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs

  • common name:
    • a trans-Δ3-cis-Δ9-hexadecenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-Δ3-cis-Δ9-hexadecenoyl-[acp" cannot be used as a page name in this wiki.