Difference between revisions of "Charged-GLY-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] == * common name: ** a glycyl-[tRNAgly] * Synonym(s): ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] ==
−
* smiles:
+
−
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
+
−
* inchi key:
+
−
** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
+
 
* common name:
 
* common name:
−
** 1-oleyl-2-lyso-phosphatidate
+
** a glycyl-[tRNAgly]
−
* molecular weight:
+
−
** 434.509   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-2-lysophosphatidate
 
−
** lysophosphatidic acid
 
−
** LPA
 
−
** oleoyl lysophosphatidic acid
 
−
** 1-oleoyl-lyso-phosphatidic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15043]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15045]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
−
* [[RXN-15046]]
+
−
* [[RXN-15068]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a glycyl-[tRNAgly]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225]
+
{{#set: produced by=GLYCINE--TRNA-LIGASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544]
+
−
* METABOLIGHTS : MTBLC74544
+
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
+
−
{{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}}
+
−
{{#set: common name=1-oleyl-2-lyso-phosphatidate}}
+
−
{{#set: molecular weight=434.509    }}
+
−
{{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}}
+
−
{{#set: consumed by=RXN-15043}}
+
−
{{#set: produced by=RXN-15045|RXN-15046|RXN-15068}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite Charged-GLY-tRNAs

  • common name:
    • a glycyl-[tRNAgly]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a glycyl-[tRNAgly" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Charged-GLY-tRNAs&oldid=29939"