Difference between revisions of "Ec-11 002020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C * inch...")
(Created page with "Category:Gene == Gene Ec-11_002020 == * left end position: ** 2153580 * transcription direction: ** NEGATIVE * right end position: ** 2156572 * centisome position: ** 34.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] ==
+
== Gene Ec-11_002020 ==
* smiles:
+
* left end position:
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
+
** 2153580
* inchi key:
+
* transcription direction:
** InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** diprenylphlorisobutyrophenone
+
** 2156572
* molecular weight:
+
* centisome position:
** 331.431    
+
** 34.240017    
 
* Synonym(s):
 
* Synonym(s):
** deoxycohumulone
+
** Esi_0157_0031
 +
** Esi0157_0031
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]]
* [[RXN-7813]]
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=2153580}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203729 25203729]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C}}
+
{{#set: right end position=2156572}}
{{#set: inchi key=InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M}}
+
{{#set: centisome position=34.240017   }}
{{#set: common name=diprenylphlorisobutyrophenone}}
+
{{#set: common name=Esi_0157_0031|Esi0157_0031}}
{{#set: molecular weight=331.431   }}
+
{{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN}}
{{#set: common name=deoxycohumulone}}
+
{{#set: produced by=RXN-7813}}
+

Latest revision as of 20:52, 21 March 2018

Gene Ec-11_002020

  • left end position:
    • 2153580
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2156572
  • centisome position:
    • 34.240017
  • Synonym(s):
    • Esi_0157_0031
    • Esi0157_0031

Reactions associated

Pathways associated

External links