Difference between revisions of "Ec-11 002020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C * inch...") |
(Created page with "Category:Gene == Gene Ec-11_002020 == * left end position: ** 2153580 * transcription direction: ** NEGATIVE * right end position: ** 2156572 * centisome position: ** 34.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_002020 == |
− | * | + | * left end position: |
− | ** | + | ** 2153580 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2156572 |
− | * | + | * centisome position: |
− | ** | + | ** 34.240017 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0157_0031 |
+ | ** Esi0157_0031 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4-NITROPHENYLPHOSPHATASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2153580}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=2156572}} |
− | {{#set: | + | {{#set: centisome position=34.240017 }} |
− | {{#set: | + | {{#set: common name=Esi_0157_0031|Esi0157_0031}} |
− | {{#set: | + | {{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Ec-11_002020
- left end position:
- 2153580
- transcription direction:
- NEGATIVE
- right end position:
- 2156572
- centisome position:
- 34.240017
- Synonym(s):
- Esi_0157_0031
- Esi0157_0031
Reactions associated
- Reaction: 4-NITROPHENYLPHOSPHATASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome