Difference between revisions of "Ec-08 004800"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
(Created page with "Category:Gene == Gene Ec-08_004800 == * left end position: ** 4602615 * transcription direction: ** POSITIVE * right end position: ** 4617987 * centisome position: ** 68.7...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_004800 == |
− | * | + | * left end position: |
− | ** | + | ** 4602615 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4617987 |
− | * | + | * centisome position: |
− | ** | + | ** 68.725845 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0338_0032 |
− | ** | + | ** Esi0338_0032 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[13-BETA-GLUCAN-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * | + | == Pathways associated == |
− | == | + | * [[PWY-6773]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=4602615}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4617987}} | |
− | + | {{#set: centisome position=68.725845 }} | |
− | + | {{#set: common name=Esi_0338_0032|Esi0338_0032}} | |
− | + | {{#set: reaction associated=13-BETA-GLUCAN-SYNTHASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6773}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:52, 21 March 2018
Gene Ec-08_004800
- left end position:
- 4602615
- transcription direction:
- POSITIVE
- right end position:
- 4617987
- centisome position:
- 68.725845
- Synonym(s):
- Esi_0338_0032
- Esi0338_0032
Reactions associated
- Reaction: 13-BETA-GLUCAN-SYNTHASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome