Difference between revisions of "Ec-01 004020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
 
(Created page with "Category:Gene == Gene Ec-01_004020 == * left end position: ** 3359915 * transcription direction: ** NEGATIVE * right end position: ** 3363767 * centisome position: ** 32.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Gene Ec-01_004020 ==
−
* smiles:
+
* left end position:
−
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** 3359915
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** XXLG xyloglucan oligosaccharide
+
** 3363767
−
* molecular weight:
+
* centisome position:
−
** 1225.073    
+
** 32.560997    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0145_0007
 +
** Esi0145_0007
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12398]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3359915}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: right end position=3363767}}
−
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: centisome position=32.560997    }}
−
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: common name=Esi_0145_0007|Esi0145_0007}}
−
{{#set: molecular weight=1225.073    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: consumed by=RXN-12398}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-01_004020

  • left end position:
    • 3359915
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3363767
  • centisome position:
    • 32.560997
  • Synonym(s):
    • Esi_0145_0007
    • Esi0145_0007

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_004020&oldid=29974"