Difference between revisions of "Stearoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] == * common name: ** a stearoyl-[acp] * Synonym(s): ** octadecanyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 14-hydroxylanosterol
+
** a stearoyl-[acp]
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
+
** octadecanyl-[acp]
 +
** a stearoyl-[acyl-carrier-protein]
 +
** an octadecanoyl-[acp]
 +
** 18:0-ACP
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-304]]
+
* [[RXN-16076]]
 +
* [[RXN-16024]]
 +
* [[RXN1G-368]]
 +
* [[RXN-9548]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-303]]
+
* [[RXN-9635]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a stearoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
{{#set: common name=octadecanyl-[acp]|a stearoyl-[acyl-carrier-protein]|an octadecanoyl-[acp]|18:0-ACP}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: consumed by=RXN-16076|RXN-16024|RXN1G-368|RXN-9548}}
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: produced by=RXN-9635}}
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-304}}
+
{{#set: produced by=RXN66-303}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite Stearoyl-ACPs

  • common name:
    • a stearoyl-[acp]
  • Synonym(s):
    • octadecanyl-[acp]
    • a stearoyl-[acyl-carrier-protein]
    • an octadecanoyl-[acp]
    • 18:0-ACP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a stearoyl-[acp" cannot be used as a page name in this wiki.
  • "octadecanyl-[acp" cannot be used as a page name in this wiki.
  • "a stearoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "an octadecanoyl-[acp" cannot be used as a page name in this wiki.