Difference between revisions of "CPD-4568"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == |
* smiles: | * smiles: | ||
| − | ** [CH]( | + | ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 14-hydroxylanosterol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 442.724 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-304]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-303]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935] |
| − | + | {{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}} | |
| − | + | {{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}} | |
| − | {{#set: smiles=[CH]( | + | {{#set: common name=14-hydroxylanosterol}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=442.724 }} |
| − | {{#set: common name= | + | {{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN66-304}} |
| − | {{#set: | + | {{#set: produced by=RXN66-303}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-4568
- smiles:
- CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
- inchi key:
- InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
- common name:
- 14-hydroxylanosterol
- molecular weight:
- 442.724
- Synonym(s):
- 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.
