Difference between revisions of "Ec-24 000030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Gene == Gene Ec-24_000030 == * left end position: ** 38402 * transcription direction: ** NEGATIVE * right end position: ** 43143 * centisome position: ** 0.769938...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Gene Ec-24_000030 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 38402
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** campest-4-en-3-one
+
** 43143
−
* molecular weight:
+
* centisome position:
−
** 398.671    
+
** 0.76993835    
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestenone
+
** Esi_0178_0007
−
** (24R)-24-methyl-cholest-4-en-3-one
+
** Esi0178_0007
−
** 3-dehydro-Δ4-5-campesterol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-711]]
+
* Reaction: [[2.4.1.151-RXN]]
−
* [[RXN-4231]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7434]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=38402}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
+
{{#set: transcription direction=NEGATIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=43143}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
{{#set: centisome position=0.76993835   }}
−
* HMDB : HMDB12196
+
{{#set: common name=Esi_0178_0007|Esi0178_0007}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction associated=2.4.1.151-RXN}}
−
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
{{#set: pathway associated=PWY-7434}}
−
{{#set: common name=campest-4-en-3-one}}
+
−
{{#set: molecular weight=398.671   }}
+
−
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
+
−
{{#set: consumed by=RXN-711|RXN-4231}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-24_000030

  • left end position:
    • 38402
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 43143
  • centisome position:
    • 0.76993835
  • Synonym(s):
    • Esi_0178_0007
    • Esi0178_0007

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000030&oldid=30017"