Difference between revisions of "Ec-20 004730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Gene == Gene Ec-20_004730 == * Synonym(s): ** Esi_0010_0215 ** Esi0010_0215 ** CAMK == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-ar...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Gene Ec-20_004730 ==
−
* smiles:
+
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
−
* inchi key:
+
−
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
−
* common name:
+
−
** campest-4-en-3-one
+
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestenone
+
** Esi_0010_0215
−
** (24R)-24-methyl-cholest-4-en-3-one
+
** Esi0010_0215
−
** 3-dehydro-Δ4-5-campesterol
+
** CAMK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-711]]
+
* Reaction: [[RXN-8443]]
−
* [[RXN-4231]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0010_0215|Esi0010_0215|CAMK}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
+
{{#set: reaction associated=RXN-8443}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
−
* HMDB : HMDB12196
+
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
−
{{#set: common name=campest-4-en-3-one}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
+
−
{{#set: consumed by=RXN-711|RXN-4231}}
+

Latest revision as of 20:53, 21 March 2018

Gene Ec-20_004730

  • Synonym(s):
    • Esi_0010_0215
    • Esi0010_0215
    • CAMK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_004730&oldid=30025"