Difference between revisions of "CPD-698"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_000810 == * left end position: ** 784882 * transcription direction: ** POSITIVE * right end position: ** 795758 * centisome position: ** 15.931...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N |
| − | * | + | * common name: |
| − | ** | + | ** campest-4-en-3-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** methylcholestenone |
| − | ** | + | ** (24R)-24-methyl-cholest-4-en-3-one |
| − | ** | + | ** 3-dehydro-Δ4-5-campesterol |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-711]] |
| − | * | + | * [[RXN-4231]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785] |
| − | {{#set: common name= | + | * HMDB : HMDB12196 |
| − | {{#set: | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
| + | {{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}} | ||
| + | {{#set: common name=campest-4-en-3-one}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}} | ||
| + | {{#set: consumed by=RXN-711|RXN-4231}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-698
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
- common name:
- campest-4-en-3-one
- molecular weight:
- 398.671
- Synonym(s):
- methylcholestenone
- (24R)-24-methyl-cholest-4-en-3-one
- 3-dehydro-Δ4-5-campesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
