Difference between revisions of "Ec-21 005710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
(Created page with "Category:Gene == Gene Ec-21_005710 == * left end position: ** 6625199 * transcription direction: ** NEGATIVE * right end position: ** 6634691 * centisome position: ** 89.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Gene Ec-21_005710 ==
−
* smiles:
+
* left end position:
−
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** 6625199
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
** 6634691
−
* molecular weight:
+
* centisome position:
−
** 262.262    
+
** 89.7709    
 
* Synonym(s):
 
* Synonym(s):
−
** salicyl-HCH
+
** Esi_0014_0076
−
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
+
** Esi0014_0076
−
** acylsaligenin
+
** PGK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12252]]
+
* Reaction: [[PHOSGLYPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY-7003]]
 +
* [[GLUCONEO-PWY]]
 +
* [[SUCSYN-PWY]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6886]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[P122-PWY]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* CAS : 529507-98-0
+
{{#set: left end position=6625199}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: right end position=6634691}}
−
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: centisome position=89.7709    }}
−
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: common name=Esi_0014_0076|Esi0014_0076|PGK}}
−
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: reaction associated=PHOSGLYPHOS-RXN}}
−
{{#set: molecular weight=262.262    }}
+
{{#set: pathway associated=PWY-1042|PWY-7003|GLUCONEO-PWY|SUCSYN-PWY|PWY-6901|P124-PWY|GLYCOLYSIS|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|P122-PWY|PWY66-399}}
−
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
−
{{#set: consumed by=RXN-12252}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-21_005710

  • left end position:
    • 6625199
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6634691
  • centisome position:
    • 89.7709
  • Synonym(s):
    • Esi_0014_0076
    • Esi0014_0076
    • PGK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_005710&oldid=30055"