|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBONUCLEOSIDE-DIP-REDUCTI-RXN RIBONUCLEOSIDE-DIP-REDUCTI-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-173 CPD-173] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(C1(C=CC=CC=1O))O |
| + | * inchi key: |
| + | ** InChIKey=CQRYARSYNCAZFO-UHFFFAOYSA-N |
| * common name: | | * common name: |
− | ** ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor | + | ** salicyl alcohol |
− | ** EsV-1-128 | + | * molecular weight: |
− | ** EsV-1-180
| + | ** 124.139 |
− | ** Ribonucleoside-diphosphate reductase small chain
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** saligenin |
| + | ** 2-hydroxybenzyl alcohol |
| + | ** o-hydroxybenzyl alcohol |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[Ribonucleoside-Diphosphates]][c] '''=>''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Deoxy-Ribonucleoside-Diphosphates]][c]
| + | * [[RXN-12252]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 a reduced thioredoxin[c] '''+''' 1 a ribonucleoside diphosphate[c] '''=>''' 1 an oxidized thioredoxin[c] '''+''' 1 H2O[c] '''+''' 1 a 2'-deoxyribonucleoside 5'-diphosphate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-06_005120]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-21_002920]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | * [[Ec-11_002170]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | * [[Ec-19_000440]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-06_005570]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 90-01-7 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23252 23252] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5146 5146] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R04294 R04294] | + | * HMDB : HMDB59709 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P89462 P89462] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02323 C02323] |
− | ** [http://www.uniprot.org/uniprot/Q7M0K8 Q7M0K8]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/Q91YM8 Q91YM8] | + | ** [http://www.chemspider.com/Chemical-Structure.4962.html 4962] |
− | ** [http://www.uniprot.org/uniprot/P09938 P09938] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q8IL94 Q8IL94]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16464 16464] |
− | ** [http://www.uniprot.org/uniprot/P32984 P32984]
| + | * METABOLIGHTS : MTBLC16464 |
− | ** [http://www.uniprot.org/uniprot/P50647 P50647] | + | {{#set: smiles=C(C1(C=CC=CC=1O))O}} |
− | ** [http://www.uniprot.org/uniprot/P50650 P50650]
| + | {{#set: inchi key=InChIKey=CQRYARSYNCAZFO-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P50620 P50620]
| + | {{#set: common name=salicyl alcohol}} |
− | ** [http://www.uniprot.org/uniprot/O83972 O83972]
| + | {{#set: molecular weight=124.139 }} |
− | ** [http://www.uniprot.org/uniprot/P43755 P43755]
| + | {{#set: common name=saligenin|2-hydroxybenzyl alcohol|o-hydroxybenzyl alcohol}} |
− | ** [http://www.uniprot.org/uniprot/Q9PJ87 Q9PJ87]
| + | {{#set: produced by=RXN-12252}} |
− | ** [http://www.uniprot.org/uniprot/P39452 P39452]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66503 O66503]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JU45 Q9JU45]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47473 P47473]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37146 P37146]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26748 O26748]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28609 O28609]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIR3 Q9PIR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JU43 Q9JU43]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55982 P55982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03190 P03190]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00452 P00452]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69924 P69924]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07201 P07201]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26713 P26713]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11158 P11158]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11157 P11157]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23921 P23921]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31350 P31350]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60561 Q60561]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03604 Q03604]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37426 P37426]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17424 P17424]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36602 P36602]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36603 P36603]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50643 P50643]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50645 P50645]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q66662 Q66662]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q66663 Q66663]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49723 P49723]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50651 P50651]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78027 P78027]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74240 P74240]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36410 O36410]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36411 O36411]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49730 P49730]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89941 Q89941]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98526 Q98526]
| + | |
− | ** [http://www.uniprot.org/uniprot/O41111 O41111]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YMK7 Q9YMK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YMI1 Q9YMI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YMI0 Q9YMI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O57175 O57175]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39262 O39262]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39263 O39263]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YTK7 Q9YTK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YTK6 Q9YTK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UW15 Q9UW15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SJ20 Q9SJ20]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03175 P03175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09247 P09247]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09248 P09248]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28847 P28847]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28846 P28846]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69520 P69520]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01319 Q01319]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10224 P10224]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16782 P16782]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20503 P20503]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26685 P26685]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12848 P12848]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor}}
| + | |
− | {{#set: common name=EsV-1-128}} | + | |
− | {{#set: common name=EsV-1-180}}
| + | |
− | {{#set: common name=Ribonucleoside-diphosphate reductase small chain}} | + | |
− | {{#set: ec number=EC-1.17.4.1}} | + | |
− | {{#set: gene associated=Ec-06_005120|Ec-21_002920|Ec-11_002170|Ec-19_000440|Ec-06_005570}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |