Difference between revisions of "Trans-D2-decenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * smiles: ** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] == * common name: ** a (2E)-dec-2-enoyl-[acp] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D2-decenoyl-ACPs Trans-D2-decenoyl-ACPs] ==
−
* smiles:
+
−
** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K
+
 
* common name:
 
* common name:
−
** D-threo-isocitrate
+
** a (2E)-dec-2-enoyl-[acp]
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-threo-isocitrate
+
** a trans-Δ2-decenoyl-[acp]
−
** (1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
+
−
** D-threo-isocitric acid
+
−
** isocitric acid
+
−
** isocitrate
+
−
** threo-Ds-isocitrate
+
−
** I-CIT
+
−
** D-isocitrate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[biomass_rxn]]
+
* [[RXN-9660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9655]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[ACONITATEHYDR-RXN]]
+
* [[5.3.3.14-RXN]]
−
* [[ISOCITDEH-RXN]]
+
−
* [[RXN-14047]]
+
−
* [[ISOCIT-CLEAV-RXN]]
+
−
* [[RXN-9951]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 320-77-4
+
{{#set: common name=a (2E)-dec-2-enoyl-[acp]}}
−
* CAS : 30810-51-6
+
{{#set: common name=a trans-Δ2-decenoyl-[acp]}}
−
* BIGG : 34579
+
{{#set: consumed by=RXN-9660}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-9655}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459771 5459771]
+
{{#set: reversible reaction associated=5.3.3.14-RXN}}
−
* KNAPSACK : C00001188
+
−
* HMDB : HMDB01874
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00451 C00451]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573553.html 4573553]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15562 15562]
+
−
* METABOLIGHTS : MTBLC15562
+
−
{{#set: smiles=C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K}}
+
−
{{#set: common name=D-threo-isocitrate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=D-threo-isocitrate|(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate|D-threo-isocitric acid|isocitric acid|isocitrate|threo-Ds-isocitrate|I-CIT|D-isocitrate}}
+
−
{{#set: consumed by=biomass_rxn}}
+
−
{{#set: consumed or produced by=ACONITATEHYDR-RXN|ISOCITDEH-RXN|RXN-14047|ISOCIT-CLEAV-RXN|RXN-9951}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite Trans-D2-decenoyl-ACPs

  • common name:
    • a (2E)-dec-2-enoyl-[acp]
  • Synonym(s):
    • a trans-Δ2-decenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (2E)-dec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"a trans-Δ2-decenoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Trans-D2-decenoyl-ACPs&oldid=30065"