Difference between revisions of "Ec-24 002360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Ec-24_002360 == * left end position: ** 2680034 * transcription direction: ** NEGATIVE * right end position: ** 2689432 * centisome position: ** 53.7...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_002360 == |
− | * | + | * left end position: |
− | ** | + | ** 2680034 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2689432 |
− | * | + | * centisome position: |
− | ** | + | ** 53.733166 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0060_0108 |
+ | ** Esi0060_0108 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-2381]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN0-2382]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[TRYPSYN-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
+ | * [[TRPSYN-PWY]] | ||
+ | * [[PWY-6949]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2680034}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2689432}} | |
− | + | {{#set: centisome position=53.733166 }} | |
− | + | {{#set: common name=Esi_0060_0108|Esi0060_0108}} | |
− | + | {{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY|PWY-6949}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:53, 21 March 2018
Gene Ec-24_002360
- left end position:
- 2680034
- transcription direction:
- NEGATIVE
- right end position:
- 2689432
- centisome position:
- 53.733166
- Synonym(s):
- Esi_0060_0108
- Esi0060_0108
Reactions associated
- Reaction: RXN0-2381
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-2382
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: TRYPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome