Difference between revisions of "Ec-28 002430"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * inchi key: ** InChIKey=HSHNIT...") |
(Created page with "Category:Gene == Gene Ec-28_002430 == * Synonym(s): ** Esi_0033_0132 ** Esi0033_0132 == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-aragem...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_002430 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0033_0132 |
+ | ** Esi0033_0132 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0033_0132|Esi0033_0132}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:53, 21 March 2018
Gene Ec-28_002430
- Synonym(s):
- Esi_0033_0132
- Esi0033_0132
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-aragem