Difference between revisions of "CPD-13174"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** salicyl-6-hydroxy-2-cyclohexene-on-oyl |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 262.262 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** salicyl-HCH |
+ | ** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester | ||
+ | ** acylsaligenin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12252]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 529507-98-0 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723] |
− | + | {{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}} | |
− | + | {{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}} | |
− | + | {{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}} | |
− | + | {{#set: molecular weight=262.262 }} | |
− | + | {{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}} | |
− | + | {{#set: consumed by=RXN-12252}} | |
− | {{#set: smiles=C( | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed | + |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-13174
- smiles:
- C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
- inchi key:
- InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
- common name:
- salicyl-6-hydroxy-2-cyclohexene-on-oyl
- molecular weight:
- 262.262
- Synonym(s):
- salicyl-HCH
- 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
- acylsaligenin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 529507-98-0
- PUBCHEM: