Difference between revisions of "CPD-15924"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_001410 == * left end position: ** 1625212 * transcription direction: ** NEGATIVE * right end position: ** 1662233 * centisome position: ** 8.57...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 1-oleoyl-2-lyso-glycerone phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 432.493 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-oleoyl-2-lyso-dihydroxyacetone phosphate |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15046]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-15044]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492] |
| − | {{#set: common name= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}} |
| + | {{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}} | ||
| + | {{#set: molecular weight=432.493 }} | ||
| + | {{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}} | ||
| + | {{#set: consumed by=RXN-15046}} | ||
| + | {{#set: produced by=RXN-15044}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD-15924
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
- inchi key:
- InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
- common name:
- 1-oleoyl-2-lyso-glycerone phosphate
- molecular weight:
- 432.493
- Synonym(s):
- 1-oleoyl-2-lyso-dihydroxyacetone phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O" cannot be used as a page name in this wiki.
