Difference between revisions of "Ec-09 002640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...")
 
(Created page with "Category:Gene == Gene Ec-09_002640 == * left end position: ** 2996775 * transcription direction: ** NEGATIVE * right end position: ** 3005140 * centisome position: ** 53.3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] ==
+
== Gene Ec-09_002640 ==
−
* smiles:
+
* left end position:
−
** C1(=CNC2(=C1C=C(O)C(O)=C2))
+
** 2996775
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SGNZYJXNUURYCH-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5,6-dihydroxyindole
+
** 3005140
−
* molecular weight:
+
* centisome position:
−
** 149.149    
+
** 53.38837    
 
* Synonym(s):
 
* Synonym(s):
−
** 1H-indole-5,6-diol
+
** Esi_0171_0026
−
** dopamine lutine
+
** Esi0171_0026
−
** DHI
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.10.1-RXN]]
−
* [[RXN-11403]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01811
+
{{#set: left end position=2996775}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=114683 114683]
+
{{#set: right end position=3005140}}
−
* HMDB : HMDB04058
+
{{#set: centisome position=53.38837   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0171_0026|Esi0171_0026}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05578 C05578]
+
{{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.102690.html 102690]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27404 27404]
+
−
{{#set: smiles=C1(=CNC2(=C1C=C(O)C(O)=C2))}}
+
−
{{#set: inchi key=InChIKey=SGNZYJXNUURYCH-UHFFFAOYSA-N}}
+
−
{{#set: common name=5,6-dihydroxyindole}}
+
−
{{#set: molecular weight=149.149   }}
+
−
{{#set: common name=1H-indole-5,6-diol|dopamine lutine|DHI}}
+
−
{{#set: produced by=RXN-11403}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-09_002640

  • left end position:
    • 2996775
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3005140
  • centisome position:
    • 53.38837
  • Synonym(s):
    • Esi_0171_0026
    • Esi0171_0026

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_002640&oldid=30099"