Difference between revisions of "Ec-04 001020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...")
 
(Created page with "Category:Gene == Gene Ec-04_001020 == * left end position: ** 1140662 * transcription direction: ** NEGATIVE * right end position: ** 1143313 * centisome position: ** 17.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Gene Ec-04_001020 ==
* smiles:
+
* left end position:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1140662
* inchi key:
+
* transcription direction:
** InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I
+
** NEGATIVE
* common name:
+
* right end position:
** (3S)-hydroxyadipyl-CoA
+
** 1143313
* molecular weight:
+
* centisome position:
** 906.621    
+
** 17.51671    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0101_0069
 +
** Esi0101_0069
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLYOXII-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-2425]]
+
*** Assignment: go-term
* [[RXN0-2044]]
+
* Reaction: [[RXN-7919]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-5386]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=1140662}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679061 70679061]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=1143313}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70990 70990]
+
{{#set: centisome position=17.51671    }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0101_0069|Esi0101_0069}}
** [http://www.genome.jp/dbget-bin/www_bget?C14145 C14145]
+
{{#set: reaction associated=GLYOXII-RXN|RXN-7919}}
* HMDB : HMDB12475
+
{{#set: pathway associated=PWY-5386}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I}}
+
{{#set: common name=(3S)-hydroxyadipyl-CoA}}
+
{{#set: molecular weight=906.621    }}
+
{{#set: consumed or produced by=RXN-2425|RXN0-2044}}
+

Latest revision as of 19:53, 21 March 2018

Gene Ec-04_001020

  • left end position:
    • 1140662
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1143313
  • centisome position:
    • 17.51671
  • Synonym(s):
    • Esi_0101_0069
    • Esi0101_0069

Reactions associated

Pathways associated

External links