Difference between revisions of "RXN-15561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15561 RXN-15561] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15561 RXN-15561] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
+
** [http://enzyme.expasy.org/EC/2.3.2.27 EC-2.3.2.27]
* common name:
+
** adenosine 5'-phosphoselenate
+
* molecular weight:
+
** 473.174   
+
 
* Synonym(s):
 
* Synonym(s):
** adenylyl-selenate
 
** APSe
 
** adenosine phosphoselenate
 
** adenylylselenate
 
** adenosine-5'-phosphoselenate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12720]]
+
** 1 [[Protein-L-lysine]][c] '''+''' 1 [[S-ubiquitinyl-UCP-E2-L-cysteine]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c] '''+''' 1 [[Ubiquitin-carrier-protein-E2-L-cysteine]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [protein]-L-lysine[c] '''+''' 1 an S-ubiquitinyl-[E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''=>''' 1 H+[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] '''+''' 1 an [E2 ubiquitin-conjugating enzyme]-L-cysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
{{#set: ec number=EC-2.3.2.27}}
* CHEBI:
+
{{#set: in pathway=PWY-7511}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
{{#set: reconstruction tool=pathwaytools}}
* HMDB : HMDB04112
+
{{#set: smiles=C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))}}
+
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M}}
+
{{#set: common name=adenosine 5'-phosphoselenate}}
+
{{#set: molecular weight=473.174    }}
+
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
{{#set: produced by=RXN-12720}}
+

Latest revision as of 19:54, 21 March 2018

Reaction RXN-15561

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7511, protein ubiquitylation: PWY-7511
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links