Difference between revisions of "Ec-01 005920"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)...")
 
(Created page with "Category:Gene == Gene Ec-01_005920 == * left end position: ** 5142200 * transcription direction: ** NEGATIVE * right end position: ** 5152486 * centisome position: ** 49.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Gene Ec-01_005920 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
+
** 5142200
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** adenosine 5'-phosphoselenate
+
** 5152486
−
* molecular weight:
+
* centisome position:
−
** 473.174    
+
** 49.83315    
 
* Synonym(s):
 
* Synonym(s):
−
** adenylyl-selenate
+
** Esi_0297_0041
−
** APSe
+
** Esi0297_0041
−
** adenosine phosphoselenate
+
−
** adenylylselenate
+
−
** adenosine-5'-phosphoselenate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PHOSPHASERSYN-RXN]]
−
* [[RXN-12720]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PHOSLIPSYN2-PWY]]
 +
* [[PWY-5669]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5142200}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5152486}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
{{#set: centisome position=49.83315   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0297_0041|Esi0297_0041}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
{{#set: reaction associated=PHOSPHASERSYN-RXN}}
−
* HMDB : HMDB04112
+
{{#set: pathway associated=PHOSLIPSYN2-PWY|PWY-5669}}
−
{{#set: smiles=C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M}}
+
−
{{#set: common name=adenosine 5'-phosphoselenate}}
+
−
{{#set: molecular weight=473.174   }}
+
−
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
−
{{#set: produced by=RXN-12720}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-01_005920

  • left end position:
    • 5142200
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5152486
  • centisome position:
    • 49.83315
  • Synonym(s):
    • Esi_0297_0041
    • Esi0297_0041

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_005920&oldid=30146"