Difference between revisions of "CPD-12852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9557 RXN-9557] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxy-cis-vaccenoyl-[acyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9557 RXN-9557] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
 
* common name:
 
* common name:
−
** 3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-8,24-dien-3β-ol
 +
** 4α,14α-dimethylzymosterol
 +
** 29-norlanosterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11881]]
−
** 1 [[R-3-hydroxy-cis-vaccenoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[cis-vaccen-2-enoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 (R)-3-hydroxy-cis-vacc-11-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-hydroxy-cis-vaccenoyl-[acyl-carrier protein] dehydratase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191]
−
{{#set: ec number=EC-4.2.1.59}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
−
{{#set: in pathway=PWY-5973}}
+
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
−
{{#set: reconstruction comment=added for gapfilling}}
+
{{#set: consumed by=RXN-11881}}

Latest revision as of 19:54, 21 March 2018

Metabolite CPD-12852

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 5α-cholesta-8,24-dien-3β-ol
    • 4α,14α-dimethylzymosterol
    • 29-norlanosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12852&oldid=30167"