Difference between revisions of "CPD-12852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11135 RXN-11135] == * direction: ** REVERSIBLE * common name: ** DNA helicase (DNA repair), Rad...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11135 RXN-11135] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
 
* common name:
 
* common name:
−
** DNA helicase (DNA repair), Rad3 type
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
−
** DNA helicase
+
* molecular weight:
−
* ec number:
+
** 412.698   
−
** [http://enzyme.expasy.org/EC/3.6.4.12 EC-3.6.4.12]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-8,24-dien-3β-ol
 +
** 4α,14α-dimethylzymosterol
 +
** 29-norlanosterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11881]]
−
** 1 [[Double-helix-DNA]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[Unwound-DNA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a double-helix DNA[c] '''+''' 1 ATP[c] '''+''' 1 H2O[c] '''<=>''' 1 phosphate[c] '''+''' 1 an unwound double-stranded DNA[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-16_002340]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-15_001630]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=DNA helicase (DNA repair), Rad3 type}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191]
−
{{#set: common name=DNA helicase}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
−
{{#set: ec number=EC-3.6.4.12}}
+
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
−
{{#set: gene associated=Ec-16_002340|Ec-15_001630}}
+
{{#set: common name=4&alpha;,14&alpha;-dimethyl-5&alpha;-cholesta-8,24-dien-3&beta;-ol}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=5&alpha;-cholesta-8,24-dien-3&beta;-ol|4&alpha;,14&alpha;-dimethylzymosterol|29-norlanosterol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-11881}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:54, 21 March 2018

Metabolite CPD-12852

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 5α-cholesta-8,24-dien-3β-ol
    • 4α,14α-dimethylzymosterol
    • 29-norlanosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12852&oldid=30167"