Difference between revisions of "RXN-7607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] == * direction: ** LEFT-TO-RIGHT * common name: ** 5'-nucleotidase * ec number:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] ==
−
* smiles:
+
* direction:
−
** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
 
* common name:
 
* common name:
−
** 2-hydroxy-dATP
+
** 5'-nucleotidase
−
* molecular weight:
+
* ec number:
−
** 503.152   
+
** [http://enzyme.expasy.org/EC/3.1.3.99 EC-3.1.3.99]
 +
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxydeoxyadenosine 5'-triphosphate
 
−
** 2'-deoxyisoguanosine triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14290]]
+
** 1 [[WATER]][c] '''+''' 1 [[IMP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[INOSINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 IMP[c] '''=>''' 1 phosphate[c] '''+''' 1 inosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_005060]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-15_000820]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-05_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27718 27718]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01126 R01126]
−
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
{{#set: common name=5'-nucleotidase}}
−
{{#set: common name=2-hydroxy-dATP}}
+
{{#set: ec number=EC-3.1.3.99}}
−
{{#set: molecular weight=503.152    }}
+
{{#set: ec number=EC-3.1.3.5}}
−
{{#set: common name=2-hydroxydeoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
{{#set: gene associated=Ec-12_005060|Ec-15_000820|Ec-05_000950}}
−
{{#set: produced by=RXN-14290}}
+
{{#set: in pathway=PWY-6596}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:54, 21 March 2018

Reaction RXN-7607

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 IMP[c] => 1 phosphate[c] + 1 inosine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6596, adenosine nucleotides degradation I: PWY-6596
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7607&oldid=30168"