Difference between revisions of "Ec-19 001690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-19_001690 == * left end position: ** 1814985 * transcription direction: ** NEGATIVE * right end position: ** 1830643 * centisome position: ** 30.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_001690 == |
− | * | + | * left end position: |
− | ** | + | ** 1814985 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1830643 |
− | * | + | * centisome position: |
− | ** | + | ** 30.398256 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0121_0078 |
− | ** | + | ** Esi0121_0078 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[HISTCYCLOHYD-RXN]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[HISTPRATPHYD-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: go-term | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[HISTSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1814985}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1830643}} | |
− | + | {{#set: centisome position=30.398256 }} | |
− | + | {{#set: common name=Esi_0121_0078|Esi0121_0078}} | |
− | + | {{#set: reaction associated=HISTCYCLOHYD-RXN|HISTPRATPHYD-RXN}} | |
− | + | {{#set: pathway associated=HISTSYN-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:54, 21 March 2018
Gene Ec-19_001690
- left end position:
- 1814985
- transcription direction:
- NEGATIVE
- right end position:
- 1830643
- centisome position:
- 30.398256
- Synonym(s):
- Esi_0121_0078
- Esi0121_0078
Reactions associated
- Reaction: HISTCYCLOHYD-RXN
- Source: orthology-aragem
- Reaction: HISTPRATPHYD-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome