Difference between revisions of "CPD-13851"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14277 RXN-14277] == * direction: ** REVERSIBLE * common name: ** hexanoyl-CoA C-acyltransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14277 RXN-14277] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
 
* common name:
 
* common name:
−
** hexanoyl-CoA C-acyltransferase
+
** 2-hydroxy-dATP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
+
** 503.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxydeoxyadenosine 5'-triphosphate
 +
** 2'-deoxyisoguanosine triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ACETYL-COA]][c] '''+''' 1 [[HEXANOYL-COA]][c] '''<=>''' 1 [[CPD0-2106]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN-14290]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 acetyl-CoA[c] '''+''' 1 hexanoyl-CoA[c] '''<=>''' 1 3-oxooctanoyl-CoA[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-26_003940]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31205 31205]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04747 R04747]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
−
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
−
{{#set: common name=hexanoyl-CoA C-acyltransferase}}
+
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
−
{{#set: ec number=EC-2.3.1.16}}
+
{{#set: common name=2-hydroxy-dATP}}
−
{{#set: gene associated=Ec-26_003940}}
+
{{#set: molecular weight=503.152    }}
−
{{#set: in pathway=}}
+
{{#set: common name=2-hydroxydeoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-14290}}
−
{{#set: reconstruction source=orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 19:54, 21 March 2018

Metabolite CPD-13851

  • smiles:
    • C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
  • common name:
    • 2-hydroxy-dATP
  • molecular weight:
    • 503.152
  • Synonym(s):
    • 2-hydroxydeoxyadenosine 5'-triphosphate
    • 2'-deoxyisoguanosine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(CC(N2(C1(=C(C(=NC(=O)N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-13851&oldid=30194"