Difference between revisions of "Ec-20 001020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2...")
(Created page with "Category:Gene == Gene Ec-20_001020 == * left end position: ** 1005204 * transcription direction: ** NEGATIVE * right end position: ** 1005606 * centisome position: ** 19.4...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] ==
+
== Gene Ec-20_001020 ==
−
* smiles:
+
* left end position:
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** 1005204
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-NADHX
+
** 1005606
−
* molecular weight:
+
* centisome position:
−
** 681.445    
+
** 19.494219    
 
* Synonym(s):
 
* Synonym(s):
−
** (6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
+
** Esi_0195_0042
 +
** Esi0195_0042
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-16226]]
−
* [[RXN-12753]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1005204}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203523 25203523]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1005606}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64074 64074]
+
{{#set: centisome position=19.494219   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0195_0042|Esi0195_0042}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04856 C04856]
+
{{#set: reaction associated=RXN-16226}}
−
* HMDB : HMDB59644
+
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L}}
+
−
{{#set: common name=(S)-NADHX}}
+
−
{{#set: molecular weight=681.445   }}
+
−
{{#set: common name=(6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
−
{{#set: produced by=RXN-12753}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-20_001020

  • left end position:
    • 1005204
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1005606
  • centisome position:
    • 19.494219
  • Synonym(s):
    • Esi_0195_0042
    • Esi0195_0042

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_001020&oldid=30208"