Difference between revisions of "Ec-12 007690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-12_007690 == * Synonym(s): ** Esi_0159_0020 ** Esi0159_0020 == Reactions associated == * Reaction: 6PGLUCONDEHYDROG-RXN ** Source: ortholog...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_007690 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0159_0020 |
+ | ** Esi0159_0020 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6PGLUCONDEHYDROG-RXN]] |
− | == | + | ** Source: [[orthology-aragem]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
+ | * [[P122-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0159_0020|Esi0159_0020}} | |
− | + | {{#set: reaction associated=6PGLUCONDEHYDROG-RXN}} | |
− | + | {{#set: pathway associated=P122-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:54, 21 March 2018
Gene Ec-12_007690
- Synonym(s):
- Esi_0159_0020
- Esi0159_0020
Reactions associated
- Reaction: 6PGLUCONDEHYDROG-RXN
- Source: orthology-aragem
- Source: orthology-aragem