Difference between revisions of "PHOSPHATIDATE-PHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDATE-PHOSPHATASE-RXN PHOSPHATIDATE-PHOSPHATASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDATE-PHOSPHATASE-RXN PHOSPHATIDATE-PHOSPHATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.4 EC-3.1.3.4] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02239 R02239] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.1.3.4}} | |
− | + | {{#set: in pathway=TRIGLSYN-PWY}} | |
− | * LIGAND- | + | {{#set: reconstruction category=annotation}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:54, 21 March 2018
Contents
Reaction PHOSPHATIDATE-PHOSPHATASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-PHOSPHATIDATE[c] + 1 WATER[c] => 1 Pi[c] + 1 DIACYLGLYCEROL[c]
- With common name(s):
- 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 a 1,2-diacyl-sn-glycerol[c]
Genes associated with this reaction
Pathways
- TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: