Difference between revisions of "CPD-14736"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7682 RXN-7682] == * direction: ** LEFT-TO-RIGHT * common name: ** xanthine dehydrogenase * ec n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) |
+ | * inchi key: | ||
+ | ** InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-kynurenine |
− | * | + | * molecular weight: |
− | ** | + | ** 208.216 |
* Synonym(s): | * Synonym(s): | ||
+ | ** kynurenine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.6.1.7-RXN]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 343-65-7 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971029 6971029] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB00684 |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01718 C01718] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57959 57959] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57959 |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N}} |
− | {{#set: | + | {{#set: common name=L-kynurenine}} |
− | {{#set: | + | {{#set: molecular weight=208.216 }} |
− | {{#set: | + | {{#set: common name=kynurenine}} |
− | + | {{#set: consumed by=KYNURENINE-3-MONOOXYGENASE-RXN}} | |
+ | {{#set: reversible reaction associated=2.6.1.7-RXN}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-14736
- smiles:
- C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)
- inchi key:
- InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N
- common name:
- L-kynurenine
- molecular weight:
- 208.216
- Synonym(s):
- kynurenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 343-65-7
- PUBCHEM:
- HMDB : HMDB00684
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57959
"C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)" cannot be used as a page name in this wiki.