Difference between revisions of "DCTP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_004820 == * left end position: ** 4627323 * transcription direction: ** NEGATIVE * right end position: ** 4638537 * centisome position: ** 69.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J |
− | * | + | * common name: |
− | ** | + | ** dCTP |
− | * | + | * molecular weight: |
− | ** | + | ** 463.127 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxycytidine-5'-triphosphate |
− | ** | + | ** deoxycytidine-triphosphate |
− | ** | + | ** deoxy-CTP |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-14216]] |
− | * | + | * [[RXN-14198]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN0-723]] |
− | * [[ | + | * [[DCDPKIN-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2056-98-6 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] |
− | {{#set: | + | * HMDB : HMDB00998 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ||
+ | * BIGG : 35027 | ||
+ | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | ||
+ | {{#set: common name=dCTP}} | ||
+ | {{#set: molecular weight=463.127 }} | ||
+ | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | ||
+ | {{#set: consumed by=RXN-14216|RXN-14198}} | ||
+ | {{#set: produced by=RXN0-723|DCDPKIN-RXN}} |
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- common name:
- dCTP
- molecular weight:
- 463.127
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.