Difference between revisions of "RXN-9222"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9222 RXN-9222] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxybenzoate nonaprenylt...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9222 RXN-9222] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J
+
 
* common name:
 
* common name:
** stearidonoyl-CoA
+
** 4-hydroxybenzoate nonaprenyltransferase
* molecular weight:
+
* ec number:
** 1021.905   
+
** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39]
 
* Synonym(s):
 
* Synonym(s):
** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-16041]]
+
** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE]][c] '''=>''' 1 [[CPD-9852]][c] '''+''' 1 [[PPI]][c]
* [[RXN-13426]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 4-hydroxybenzoate[c] '''+''' 1 all-trans-heptaprenyl diphosphate[c] '''=>''' 1 3-heptaprenyl-4-hydroxybenzoate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_007360]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5873]], ubiquinol-7 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5873 PWY-5873]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-5855]], ubiquinol-7 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5855 PWY-5855]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698349 70698349]
+
{{#set: common name=4-hydroxybenzoate nonaprenyltransferase}}
* CHEBI:
+
{{#set: ec number=EC-2.5.1.39}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71489 71489]
+
{{#set: gene associated=Ec-00_007360}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-5873|PWY-5855}}
{{#set: inchi key=InChIKey=DDHCSALWDPRVCN-USWKVXSKSA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=stearidonoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: molecular weight=1021.905    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl-coA}}
+
{{#set: produced by=RXN-16041|RXN-13426}}
+

Latest revision as of 20:55, 21 March 2018

Reaction RXN-9222

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4-hydroxybenzoate nonaprenyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5873, ubiquinol-7 biosynthesis (eukaryotic): PWY-5873
    • 1 reactions found over 8 reactions in the full pathway
  • PWY-5855, ubiquinol-7 biosynthesis (prokaryotic): PWY-5855
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links