Difference between revisions of "Ec-13 002300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-13_002300 == * left end position: ** 3922649 * transcription direction: ** POSITIVE * right end position: ** 3931272 * centisome position: ** 56.5...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
+
== Gene Ec-13_002300 ==
* smiles:
+
* left end position:
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
+
** 3922649
* inchi key:
+
* transcription direction:
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
+
** POSITIVE
* common name:
+
* right end position:
** β-L-galactose 1-phosphate
+
** 3931272
* molecular weight:
+
* centisome position:
** 258.121    
+
** 56.55274    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0363_0007
 +
** Esi0363_0007
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXNQT-4142]]
+
* Reaction: [[3.4.25.1-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXNQT-4141]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=3922649}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=3931272}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
+
{{#set: centisome position=56.55274   }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0363_0007|Esi0363_0007}}
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
+
{{#set: reaction associated=3.4.25.1-RXN}}
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
+
{{#set: common name=β-L-galactose 1-phosphate}}
+
{{#set: molecular weight=258.121   }}
+
{{#set: consumed by=RXNQT-4142}}
+
{{#set: produced by=RXNQT-4141}}
+

Latest revision as of 19:55, 21 March 2018

Gene Ec-13_002300

  • left end position:
    • 3922649
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3931272
  • centisome position:
    • 56.55274
  • Synonym(s):
    • Esi_0363_0007
    • Esi0363_0007

Reactions associated

Pathways associated

External links