Difference between revisions of "GDP-L-GALACTOSE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_000740 == * left end position: ** 693754 * transcription direction: ** POSITIVE * right end position: ** 724035 * centisome position: ** 14.081...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L |
− | * | + | * common name: |
− | ** | + | ** GDP-β-L-galactose |
− | * | + | * molecular weight: |
− | ** | + | ** 603.329 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXNQT-4141]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-1882]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280] |
− | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}} |
+ | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}} | ||
+ | {{#set: common name=GDP-β-L-galactose}} | ||
+ | {{#set: molecular weight=603.329 }} | ||
+ | {{#set: consumed by=RXNQT-4141}} | ||
+ | {{#set: reversible reaction associated=RXN-1882}} |
Latest revision as of 20:55, 21 March 2018
Contents
Metabolite GDP-L-GALACTOSE
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
- common name:
- GDP-β-L-galactose
- molecular weight:
- 603.329
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O" cannot be used as a page name in this wiki.