Difference between revisions of "Ec-01 005250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...")
 
(Created page with "Category:Gene == Gene Ec-01_005250 == * left end position: ** 4522952 * transcription direction: ** POSITIVE * right end position: ** 4533396 * centisome position: ** 43.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] ==
+
== Gene Ec-01_005250 ==
−
* smiles:
+
* left end position:
−
** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
+
** 4522952
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** kaempferol
+
** 4533396
−
* molecular weight:
+
* centisome position:
−
** 285.232    
+
** 43.83201    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0018_0073
 +
** Esi0018_0073
 +
** SPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-461]]
+
* Reaction: [[2.7.9.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN1F-93]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY0-901]]
 +
* [[PWY-6281]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4522952}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202062 25202062]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4533396}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58573 58573]
+
{{#set: centisome position=43.83201    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0018_0073|Esi0018_0073|SPS}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05903 C05903]
+
{{#set: reaction associated=2.7.9.3-RXN}}
−
* HMDB : HMDB05801
+
{{#set: pathway associated=PWY0-901|PWY-6281}}
−
{{#set: smiles=C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)}}
+
−
{{#set: inchi key=InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M}}
+
−
{{#set: common name=kaempferol}}
+
−
{{#set: molecular weight=285.232    }}
+
−
{{#set: consumed by=RXN1F-461}}
+
−
{{#set: produced by=RXN1F-93}}
+

Latest revision as of 19:55, 21 March 2018

Gene Ec-01_005250

  • left end position:
    • 4522952
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4533396
  • centisome position:
    • 43.83201
  • Synonym(s):
    • Esi_0018_0073
    • Esi0018_0073
    • SPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_005250&oldid=30301"