Difference between revisions of "CPD1F-90"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** kaempferol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 285.232 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1F-461]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-93]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202062 25202062] |
− | {{#set: smiles=C | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58573 58573] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05903 C05903] |
− | + | * HMDB : HMDB05801 | |
− | {{#set: consumed by= | + | {{#set: smiles=C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)}} |
− | {{#set: produced by= | + | {{#set: inchi key=InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M}} |
+ | {{#set: common name=kaempferol}} | ||
+ | {{#set: molecular weight=285.232 }} | ||
+ | {{#set: consumed by=RXN1F-461}} | ||
+ | {{#set: produced by=RXN1F-93}} |
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD1F-90
- smiles:
- C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
- inchi key:
- InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
- common name:
- kaempferol
- molecular weight:
- 285.232
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)" cannot be used as a page name in this wiki.