Difference between revisions of "CPD-17383"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_003100 == * left end position: ** 3558980 * transcription direction: ** NEGATIVE * right end position: ** 3569594 * centisome position: ** 63.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J |
| − | * | + | * common name: |
| − | ** | + | ** (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1102.034 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16131]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-16130]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551529 72551529] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76464 76464] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J}} |
| + | {{#set: common name=(2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}} | ||
| + | {{#set: molecular weight=1102.034 }} | ||
| + | {{#set: consumed by=RXN-16131}} | ||
| + | {{#set: produced by=RXN-16130}} | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-17383
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J
- common name:
- (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
- molecular weight:
- 1102.034
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
