Difference between revisions of "CPD-17046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-15_000120 == * left end position: ** 203531 * transcription direction: ** NEGATIVE * right end position: ** 213966 * centisome position: ** 3.7703...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-15_000120 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] ==
* left end position:
+
* smiles:
** 203531
+
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
* right end position:
+
* common name:
** 213966
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
* centisome position:
+
* molecular weight:
** 3.7703123    
+
** 842.848    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0012_0174
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
** Esi0012_0174
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ADENYL-KIN-RXN]]
+
* [[RXN-15681]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-15680]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=203531}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797]
{{#set: right end position=213966}}
+
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
{{#set: centisome position=3.7703123   }}
+
{{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}}
{{#set: common name=Esi_0012_0174|Esi0012_0174}}
+
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
{{#set: reaction associated=ADENYL-KIN-RXN}}
+
{{#set: molecular weight=842.848   }}
{{#set: pathway associated=PWY-7219}}
+
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15681}}
 +
{{#set: produced by=RXN-15680}}

Latest revision as of 19:55, 21 March 2018

Metabolite CPD-17046

  • smiles:
    • C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
  • inchi key:
    • InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
  • common name:
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 842.848
  • Synonym(s):
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.