Difference between revisions of "3.4.24.70-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * inchi key: ** InChIKey=OSJPPGNTCRNQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.24.70-RXN 3.4.24.70-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** oligopeptidase A *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.24.70-RXN 3.4.24.70-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** oligopeptidase A |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.24.70 EC-3.4.24.70] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[OLIGOPEPTIDES]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 an oligopeptide[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c] | |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-20_002090]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/Q9JX57 Q9JX57] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=oligopeptidase A}} | |
− | + | {{#set: ec number=EC-3.4.24.70}} | |
− | + | {{#set: gene associated=Ec-20_002090}} | |
− | ** [http://www. | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:55, 21 March 2018
Contents
Reaction 3.4.24.70-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- oligopeptidase A
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OLIGOPEPTIDES[c] + 1 WATER[c] => 1 Peptides-holder[c]
- With common name(s):
- 1 an oligopeptide[c] + 1 H2O[c] => 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-20_002090
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- UNIPROT: