Difference between revisions of "CPD-7257"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-17_003930 == * left end position: ** 4146579 * transcription direction: ** NEGATIVE * right end position: ** 4155691 * centisome position: ** 86.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7257 CPD-7257] == * smiles: ** CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7257 CPD-7257] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AWLXQJGPNLCTLM-YFXOTMPNSA-J |
− | * | + | * common name: |
− | ** | + | ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1210.128 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-α,7-α,12-α-trihydroxy-24-oxo-5-β-cholestanoyl CoA |
− | ** | + | ** 3alpha,7alpha,12alpha-trihydroxy-24-oxo-5beta-cholestanoyl-CoA |
+ | ** 3alpha,7alpha,12alpha-trihydroxy-5beta-24-oxocholestanoyl-CoA | ||
+ | ** 3α,7α,12α-trihydroxy-5β-cholest-24-one-CoA | ||
+ | ** 24-keto,(25R)-trihydroxycholestanoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.3.1.176-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926260 46926260] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27379 27379] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05467 C05467] |
+ | * HMDB : HMDB06891 | ||
+ | {{#set: smiles=CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7))))}} | ||
+ | {{#set: inchi key=InChIKey=AWLXQJGPNLCTLM-YFXOTMPNSA-J}} | ||
+ | {{#set: common name=3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA}} | ||
+ | {{#set: molecular weight=1210.128 }} | ||
+ | {{#set: common name=3-α,7-α,12-α-trihydroxy-24-oxo-5-β-cholestanoyl CoA|3alpha,7alpha,12alpha-trihydroxy-24-oxo-5beta-cholestanoyl-CoA|3alpha,7alpha,12alpha-trihydroxy-5beta-24-oxocholestanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholest-24-one-CoA|24-keto,(25R)-trihydroxycholestanoyl-CoA}} | ||
+ | {{#set: consumed by=2.3.1.176-RXN}} |
Latest revision as of 20:56, 21 March 2018
Contents
Metabolite CPD-7257
- smiles:
- CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7))))
- inchi key:
- InChIKey=AWLXQJGPNLCTLM-YFXOTMPNSA-J
- common name:
- 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA
- molecular weight:
- 1210.128
- Synonym(s):
- 3-α,7-α,12-α-trihydroxy-24-oxo-5-β-cholestanoyl CoA
- 3alpha,7alpha,12alpha-trihydroxy-24-oxo-5beta-cholestanoyl-CoA
- 3alpha,7alpha,12alpha-trihydroxy-5beta-24-oxocholestanoyl-CoA
- 3α,7α,12α-trihydroxy-5β-cholest-24-one-CoA
- 24-keto,(25R)-trihydroxycholestanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC(=O)C(C)C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)[CH]4(CC[CH]5(C(C)4C(O)C[CH]6([CH]5C(O)C[CH]7(C(C)6CCC(O)C7))))" cannot be used as a page name in this wiki.